C22H18IN3O3S — CID 75408527
(1E)-1-[2-(4-iodophenyl)-3H-isoindol-1-ylidene]-3-(4-methylphenyl)sulfonylurea (PubChem CID 75408527) has the molecular formula C22H18IN3O3S and a molecular weight of 531.38 g/mol. Its IUPAC name is (1E)-1-[2-(4-iodophenyl)-3H-isoindol-1-ylidene]-3-(4-methylphenyl)sulfonylurea.
| Compound Name | (1E)-1-[2-(4-iodophenyl)-3H-isoindol-1-ylidene]-3-(4-methylphenyl)sulfonylurea |
|---|---|
| PubChem CID | 75408527 |
| Molecular Formula | C22H18IN3O3S |
| Molecular Weight | 531.38 g/mol |
| Exact Mass | 531.01 |
| IUPAC Name | (1E)-1-[2-(4-iodophenyl)-3H-isoindol-1-ylidene]-3-(4-methylphenyl)sulfonylurea |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)/N=C2\c3ccccc3CN2c2ccc(I)cc2)cc1 |
| InChI | InChI=1S/C22H18IN3O3S/c1-15-6-12-19(13-7-15)30(28,29)25-22(27)24-21-20-5-3-2-4-16(20)14-26(21)18-10-8-17(23)9-11-18/h2-13H,14H2,1H3,(H,25,27)/b24-21+ |
| InChIKey | VFPHVEQFLUPEFN-DARPEHSRSA-N |
| XLogP | 4.46 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.38 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|