C31H34F16N2O4 — CID 23225194
2-[4-[1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-8-[1-(1-methoxyethoxy)ethoxy]octoxy]phenyl]-5-octylpyrimidine (PubChem CID 23225194) has the molecular formula C31H34F16N2O4 and a molecular weight of 802.59 g/mol. Its IUPAC name is 2-[4-[1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-8-[1-(1-methoxyethoxy)ethoxy]octoxy]phenyl]-5-octylpyrimidine.
| Compound Name | 2-[4-[1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-8-[1-(1-methoxyethoxy)ethoxy]octoxy]phenyl]-5-octylpyrimidine |
|---|---|
| PubChem CID | 23225194 |
| Molecular Formula | C31H34F16N2O4 |
| Molecular Weight | 802.59 g/mol |
| Exact Mass | 802.23 |
| IUPAC Name | 2-[4-[1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-8-[1-(1-methoxyethoxy)ethoxy]octoxy]phenyl]-5-octylpyrimidine |
| SMILES | CCCCCCCCc1cnc(-c2ccc(OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)OC(C)OC(C)OC)cc2)nc1 |
| InChI | InChI=1S/C31H34F16N2O4/c1-5-6-7-8-9-10-11-20-16-48-23(49-17-20)21-12-14-22(15-13-21)53-31(46,47)29(42,43)27(38,39)25(34,35)24(32,33)26(36,37)28(40,41)30(44,45)52-19(3)51-18(2)50-4/h12-19H,5-11H2,1-4H3 |
| InChIKey | KQTQCJGZLAFCKG-UHFFFAOYSA-N |
| XLogP | 10.79 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.59 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|