C31H38F12N2O5 — CID 23225207
2-[4-[1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-6-[1-[1-(1-methoxyethoxy)ethoxy]ethoxy]hexoxy]phenyl]-5-octylpyrimidine (PubChem CID 23225207) has the molecular formula C31H38F12N2O5 and a molecular weight of 746.63 g/mol. Its IUPAC name is 2-[4-[1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-6-[1-[1-(1-methoxyethoxy)ethoxy]ethoxy]hexoxy]phenyl]-5-octylpyrimidine.
| Compound Name | 2-[4-[1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-6-[1-[1-(1-methoxyethoxy)ethoxy]ethoxy]hexoxy]phenyl]-5-octylpyrimidine |
|---|---|
| PubChem CID | 23225207 |
| Molecular Formula | C31H38F12N2O5 |
| Molecular Weight | 746.63 g/mol |
| Exact Mass | 746.26 |
| IUPAC Name | 2-[4-[1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-6-[1-[1-(1-methoxyethoxy)ethoxy]ethoxy]hexoxy]phenyl]-5-octylpyrimidine |
| SMILES | CCCCCCCCc1cnc(-c2ccc(OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)OC(C)OC(C)OC(C)OC)cc2)nc1 |
| InChI | InChI=1S/C31H38F12N2O5/c1-6-7-8-9-10-11-12-22-17-44-25(45-18-22)23-13-15-24(16-14-23)50-31(42,43)29(38,39)27(34,35)26(32,33)28(36,37)30(40,41)49-21(4)48-20(3)47-19(2)46-5/h13-21H,6-12H2,1-5H3 |
| InChIKey | NIRLUOLDNLMMPQ-UHFFFAOYSA-N |
| XLogP | 9.89 |
| TPSA | 71.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.63 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|