C21H36Cl2OTi — CID 23232287
tert-butylcyclopentane;dichlorotitanium;2,6-di(propan-2-yl)phenol (PubChem CID 23232287) has the molecular formula C21H36Cl2OTi and a molecular weight of 423.29 g/mol. Its IUPAC name is tert-butylcyclopentane;dichlorotitanium;2,6-di(propan-2-yl)phenol.
| Compound Name | tert-butylcyclopentane;dichlorotitanium;2,6-di(propan-2-yl)phenol |
|---|---|
| PubChem CID | 23232287 |
| Molecular Formula | C21H36Cl2OTi |
| Molecular Weight | 423.29 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | tert-butylcyclopentane;dichlorotitanium;2,6-di(propan-2-yl)phenol |
| SMILES | CC(C)(C)C1CCCC1.CC(C)c1cccc(C(C)C)c1O.Cl[Ti]Cl |
| InChI | InChI=1S/C12H18O.C9H18.2ClH.Ti/c1-8(2)10-6-5-7-11(9(3)4)12(10)13;1-9(2,3)8-6-4-5-7-8;;;/h5-9,13H,1-4H3;8H,4-7H2,1-3H3;2*1H;/q;;;;+2/p-2 |
| InChIKey | GDVDKDVEAKLUGQ-UHFFFAOYSA-L |
| XLogP | 8.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.29 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |