C23H34O6 — CID 23232550
dimethyl (1R,5S,6R,9S,11R,12R)-6-butyl-9-ethyl-2,14-dioxatetracyclo[7.4.2.01,8.05,13]pentadec-7-ene-11,12-dicarboxylate (PubChem CID 23232550) has the molecular formula C23H34O6 and a molecular weight of 406.52 g/mol. Its IUPAC name is dimethyl (1R,5S,6R,9S,11R,12R)-6-butyl-9-ethyl-2,14-dioxatetracyclo[7.4.2.01,8.05,13]pentadec-7-ene-11,12-dicarboxylate.
| Compound Name | dimethyl (1R,5S,6R,9S,11R,12R)-6-butyl-9-ethyl-2,14-dioxatetracyclo[7.4.2.01,8.05,13]pentadec-7-ene-11,12-dicarboxylate |
|---|---|
| PubChem CID | 23232550 |
| Molecular Formula | C23H34O6 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | dimethyl (1R,5S,6R,9S,11R,12R)-6-butyl-9-ethyl-2,14-dioxatetracyclo[7.4.2.01,8.05,13]pentadec-7-ene-11,12-dicarboxylate |
| SMILES | CCCC[C@H]1C=C2[C@@]3(CC)CO[C@@]24OCC[C@@H]1C4C(C(=O)OC)[C@H](C(=O)OC)C3 |
| InChI | InChI=1S/C23H34O6/c1-5-7-8-14-11-17-22(6-2)12-16(20(24)26-3)18(21(25)27-4)19-15(14)9-10-28-23(17,19)29-13-22/h11,14-16,18-19H,5-10,12-13H2,1-4H3/t14-,15-,16+,18?,19?,22+,23-/m0/s1 |
| InChIKey | DLRRPRUMTPAJRB-UWWNOLQUSA-N |
| XLogP | 3.49 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|