C23H34O6 — CID 135006041
dimethyl (9R)-6-butyl-9-ethyl-2,14-dioxapentacyclo[7.4.2.01,8.05,13.07,11]pentadecane-11,12-dicarboxylate (PubChem CID 135006041) has the molecular formula C23H34O6 and a molecular weight of 406.52 g/mol. Its IUPAC name is dimethyl (9R)-6-butyl-9-ethyl-2,14-dioxapentacyclo[7.4.2.01,8.05,13.07,11]pentadecane-11,12-dicarboxylate.
| Compound Name | dimethyl (9R)-6-butyl-9-ethyl-2,14-dioxapentacyclo[7.4.2.01,8.05,13.07,11]pentadecane-11,12-dicarboxylate |
|---|---|
| PubChem CID | 135006041 |
| Molecular Formula | C23H34O6 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | dimethyl (9R)-6-butyl-9-ethyl-2,14-dioxapentacyclo[7.4.2.01,8.05,13.07,11]pentadecane-11,12-dicarboxylate |
| SMILES | CCCCC1C2CCOC34OC[C@]5(CC)CC(C(=O)OC)(C(C(=O)OC)C23)C1C45 |
| InChI | InChI=1S/C23H34O6/c1-5-7-8-13-14-9-10-28-23-15(14)17(19(24)26-3)22(20(25)27-4)11-21(6-2,12-29-23)18(23)16(13)22/h13-18H,5-12H2,1-4H3/t13?,14?,15?,16?,17?,18?,21-,22?,23?/m0/s1 |
| InChIKey | JIRXXQVVUIQPKE-YKVXHXPUSA-N |
| XLogP | 3.18 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |