C9H9F7 — CID 23233433
1-(1,1,2,2,3,3,3-heptafluoropropyl)cyclohexene (PubChem CID 23233433) has the molecular formula C9H9F7 and a molecular weight of 250.16 g/mol. Its IUPAC name is 1-(1,1,2,2,3,3,3-heptafluoropropyl)cyclohexene.
| Compound Name | 1-(1,1,2,2,3,3,3-heptafluoropropyl)cyclohexene |
|---|---|
| PubChem CID | 23233433 |
| Molecular Formula | C9H9F7 |
| Molecular Weight | 250.16 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 1-(1,1,2,2,3,3,3-heptafluoropropyl)cyclohexene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C1=CCCCC1 |
| InChI | InChI=1S/C9H9F7/c10-7(11,6-4-2-1-3-5-6)8(12,13)9(14,15)16/h4H,1-3,5H2 |
| InChIKey | QBRIXMCTODUQPD-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.16 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|