C9H4F6 — CID 23233729
5-ethenyl-1,2,3,4,7,7-hexafluorobicyclo[2.2.1]hepta-2,5-diene (PubChem CID 23233729) has the molecular formula C9H4F6 and a molecular weight of 226.12 g/mol. Its IUPAC name is 5-ethenyl-1,2,3,4,7,7-hexafluorobicyclo[2.2.1]hepta-2,5-diene.
| Compound Name | 5-ethenyl-1,2,3,4,7,7-hexafluorobicyclo[2.2.1]hepta-2,5-diene |
|---|---|
| PubChem CID | 23233729 |
| Molecular Formula | C9H4F6 |
| Molecular Weight | 226.12 g/mol |
| Exact Mass | 226.02 |
| IUPAC Name | 5-ethenyl-1,2,3,4,7,7-hexafluorobicyclo[2.2.1]hepta-2,5-diene |
| SMILES | C=CC1=CC2(F)C(F)=C(F)C1(F)C2(F)F |
| InChI | InChI=1S/C9H4F6/c1-2-4-3-7(12)5(10)6(11)8(4,13)9(7,14)15/h2-3H,1H2 |
| InChIKey | UDGFEZJYHHNUCX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.12 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |