C23H20N2OS — CID 2323604
(5R,9E)-9-benzylidene-5-phenyl-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazolin-3-one (PubChem CID 2323604) has the molecular formula C23H20N2OS and a molecular weight of 372.49 g/mol. Its IUPAC name is (5R,9E)-9-benzylidene-5-phenyl-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazolin-3-one.
| Compound Name | (5R,9E)-9-benzylidene-5-phenyl-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazolin-3-one |
|---|---|
| PubChem CID | 2323604 |
| Molecular Formula | C23H20N2OS |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | (5R,9E)-9-benzylidene-5-phenyl-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazolin-3-one |
| SMILES | O=C1CSC2=NC3=C(CCC/C3=C\c3ccccc3)[C@@H](c3ccccc3)N12 |
| InChI | InChI=1S/C23H20N2OS/c26-20-15-27-23-24-21-18(14-16-8-3-1-4-9-16)12-7-13-19(21)22(25(20)23)17-10-5-2-6-11-17/h1-6,8-11,14,22H,7,12-13,15H2/b18-14+/t22-/m1/s1 |
| InChIKey | XGROEMAYQGXGMT-OVWUPXBPSA-N |
| XLogP | 5.19 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |