C20H15FN2OS — CID 1207417
(11R)-11-(4-fluorophenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 1207417) has the molecular formula C20H15FN2OS and a molecular weight of 350.42 g/mol. Its IUPAC name is (11R)-11-(4-fluorophenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | (11R)-11-(4-fluorophenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 1207417 |
| Molecular Formula | C20H15FN2OS |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | (11R)-11-(4-fluorophenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | O=C1CSC2=NC3=C(CCc4ccccc43)[C@@H](c3ccc(F)cc3)N12 |
| InChI | InChI=1S/C20H15FN2OS/c21-14-8-5-13(6-9-14)19-16-10-7-12-3-1-2-4-15(12)18(16)22-20-23(19)17(24)11-25-20/h1-6,8-9,19H,7,10-11H2/t19-/m1/s1 |
| InChIKey | KTYWJNIRCLRHPW-LJQANCHMSA-N |
| XLogP | 4.17 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |