C22H26F2O2 — CID 23237683
(4R,5S)-3,3-difluoro-4-(2-phenylethyl)-5-(2-phenylmethoxyethyl)oxane (PubChem CID 23237683) has the molecular formula C22H26F2O2 and a molecular weight of 360.44 g/mol. Its IUPAC name is (4R,5S)-3,3-difluoro-4-(2-phenylethyl)-5-(2-phenylmethoxyethyl)oxane.
| Compound Name | (4R,5S)-3,3-difluoro-4-(2-phenylethyl)-5-(2-phenylmethoxyethyl)oxane |
|---|---|
| PubChem CID | 23237683 |
| Molecular Formula | C22H26F2O2 |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | (4R,5S)-3,3-difluoro-4-(2-phenylethyl)-5-(2-phenylmethoxyethyl)oxane |
| SMILES | FC1(F)COC[C@@H](CCOCc2ccccc2)[C@H]1CCc1ccccc1 |
| InChI | InChI=1S/C22H26F2O2/c23-22(24)17-26-16-20(13-14-25-15-19-9-5-2-6-10-19)21(22)12-11-18-7-3-1-4-8-18/h1-10,20-21H,11-17H2/t20-,21-/m1/s1 |
| InChIKey | MSZJRMAKMXHBME-NHCUHLMSSA-N |
| XLogP | 5.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|