C12H13BrF2 — CID 125475006
2-[(1S,3R)-3-(bromomethyl)-2,2-difluorocyclopropyl]ethylbenzene (PubChem CID 125475006) has the molecular formula C12H13BrF2 and a molecular weight of 275.14 g/mol. Its IUPAC name is 2-[(1S,3R)-3-(bromomethyl)-2,2-difluorocyclopropyl]ethylbenzene.
| Compound Name | 2-[(1S,3R)-3-(bromomethyl)-2,2-difluorocyclopropyl]ethylbenzene |
|---|---|
| PubChem CID | 125475006 |
| Molecular Formula | C12H13BrF2 |
| Molecular Weight | 275.14 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 2-[(1S,3R)-3-(bromomethyl)-2,2-difluorocyclopropyl]ethylbenzene |
| SMILES | FC1(F)[C@H](CBr)[C@@H]1CCc1ccccc1 |
| InChI | InChI=1S/C12H13BrF2/c13-8-11-10(12(11,14)15)7-6-9-4-2-1-3-5-9/h1-5,10-11H,6-8H2/t10-,11+/m0/s1 |
| InChIKey | IFYWPIAGLUWYRG-WDEREUQCSA-N |
| XLogP | 3.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.14 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|