C11H5Br2NO2S2 — CID 23238181
(5E)-5-[2-(2,5-dibromophenyl)-2-oxoethylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 23238181) has the molecular formula C11H5Br2NO2S2 and a molecular weight of 407.11 g/mol. Its IUPAC name is (5E)-5-[2-(2,5-dibromophenyl)-2-oxoethylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[2-(2,5-dibromophenyl)-2-oxoethylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 23238181 |
| Molecular Formula | C11H5Br2NO2S2 |
| Molecular Weight | 407.11 g/mol |
| Exact Mass | 404.81 |
| IUPAC Name | (5E)-5-[2-(2,5-dibromophenyl)-2-oxoethylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1NC(=S)S/C1=C/C(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C11H5Br2NO2S2/c12-5-1-2-7(13)6(3-5)8(15)4-9-10(16)14-11(17)18-9/h1-4H,(H,14,16,17)/b9-4+ |
| InChIKey | IUCOEPCHBFQYKL-RUDMXATFSA-N |
| XLogP | 3.43 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.11 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|