C8H7NOS2 — CID 123191977
5-(2-methylidenebut-3-enylidene)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 123191977) has the molecular formula C8H7NOS2 and a molecular weight of 197.28 g/mol. Its IUPAC name is 5-(2-methylidenebut-3-enylidene)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-(2-methylidenebut-3-enylidene)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 123191977 |
| Molecular Formula | C8H7NOS2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.00 |
| IUPAC Name | 5-(2-methylidenebut-3-enylidene)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | C=CC(=C)C=C1SC(=S)NC1=O |
| InChI | InChI=1S/C8H7NOS2/c1-3-5(2)4-6-7(10)9-8(11)12-6/h3-4H,1-2H2,(H,9,10,11) |
| InChIKey | FALKQPBPGUIBHY-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|