C4H2AuNOS2Se — CID 59102002
CID 59102002 (PubChem CID 59102002) has the molecular formula C4H2AuNOS2Se and a molecular weight of 420.13 g/mol.
| Compound Name | CID 59102002 |
|---|---|
| PubChem CID | 59102002 |
| Molecular Formula | C4H2AuNOS2Se |
| Molecular Weight | 420.13 g/mol |
| Exact Mass | 420.84 |
| IUPAC Name | — |
| SMILES | O=C1NC(=S)S/C1=C\[Se].[Au] |
| InChI | InChI=1S/C4H2NOS2Se.Au/c6-3-2(1-9)8-4(7)5-3;/h1H,(H,5,6,7);/b2-1-; |
| InChIKey | IAGOSKVAAUNPQV-ODZAUARKSA-N |
| XLogP | 0.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.13 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|