C23H52N5O7P3 — CID 23238282
N-methyl-2-[4,7,10-tris[[ethoxy(methyl)phosphoryl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetamide (PubChem CID 23238282) has the molecular formula C23H52N5O7P3 and a molecular weight of 603.62 g/mol. Its IUPAC name is N-methyl-2-[4,7,10-tris[[ethoxy(methyl)phosphoryl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetamide.
| Compound Name | N-methyl-2-[4,7,10-tris[[ethoxy(methyl)phosphoryl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetamide |
|---|---|
| PubChem CID | 23238282 |
| Molecular Formula | C23H52N5O7P3 |
| Molecular Weight | 603.62 g/mol |
| Exact Mass | 603.31 |
| IUPAC Name | N-methyl-2-[4,7,10-tris[[ethoxy(methyl)phosphoryl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetamide |
| SMILES | CCOP(C)(=O)CN1CCN(CC(=O)NC)CCN(CP(C)(=O)OCC)CCN(CP(C)(=O)OCC)CC1 |
| InChI | InChI=1S/C23H52N5O7P3/c1-8-33-36(5,30)20-26-13-11-25(19-23(29)24-4)12-14-27(21-37(6,31)34-9-2)16-18-28(17-15-26)22-38(7,32)35-10-3/h8-22H2,1-7H3,(H,24,29) |
| InChIKey | DRCBUDFZMFQKKK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 120.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.62 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|