C9H19N3O4S — CID 58776126
[4-[2-(methylamino)-2-oxoethyl]piperazin-1-yl]methyl methanesulfonate (PubChem CID 58776126) has the molecular formula C9H19N3O4S and a molecular weight of 265.33 g/mol. Its IUPAC name is [4-[2-(methylamino)-2-oxoethyl]piperazin-1-yl]methyl methanesulfonate.
| Compound Name | [4-[2-(methylamino)-2-oxoethyl]piperazin-1-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 58776126 |
| Molecular Formula | C9H19N3O4S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | [4-[2-(methylamino)-2-oxoethyl]piperazin-1-yl]methyl methanesulfonate |
| SMILES | CNC(=O)CN1CCN(COS(C)(=O)=O)CC1 |
| InChI | InChI=1S/C9H19N3O4S/c1-10-9(13)7-11-3-5-12(6-4-11)8-16-17(2,14)15/h3-8H2,1-2H3,(H,10,13) |
| InChIKey | WKWXCZOQBUVGOQ-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|