C11H24O3 — CID 23238601
(2R,4R)-1,4-dimethoxynonan-2-ol (PubChem CID 23238601) has the molecular formula C11H24O3 and a molecular weight of 204.31 g/mol. Its IUPAC name is (2R,4R)-1,4-dimethoxynonan-2-ol.
| Compound Name | (2R,4R)-1,4-dimethoxynonan-2-ol |
|---|---|
| PubChem CID | 23238601 |
| Molecular Formula | C11H24O3 |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.17 |
| IUPAC Name | (2R,4R)-1,4-dimethoxynonan-2-ol |
| SMILES | CCCCC[C@H](C[C@@H](O)COC)OC |
| InChI | InChI=1S/C11H24O3/c1-4-5-6-7-11(14-3)8-10(12)9-13-2/h10-12H,4-9H2,1-3H3/t10-,11-/m1/s1 |
| InChIKey | WPWLUIJJQWYQAB-GHMZBOCLSA-N |
| XLogP | 1.98 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|