C13H13F6NO3 — CID 23238709
propyl N-(1,1,1,3,3,3-hexafluoro-2-phenoxypropan-2-yl)carbamate (PubChem CID 23238709) has the molecular formula C13H13F6NO3 and a molecular weight of 345.24 g/mol. Its IUPAC name is propyl N-(1,1,1,3,3,3-hexafluoro-2-phenoxypropan-2-yl)carbamate.
| Compound Name | propyl N-(1,1,1,3,3,3-hexafluoro-2-phenoxypropan-2-yl)carbamate |
|---|---|
| PubChem CID | 23238709 |
| Molecular Formula | C13H13F6NO3 |
| Molecular Weight | 345.24 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | propyl N-(1,1,1,3,3,3-hexafluoro-2-phenoxypropan-2-yl)carbamate |
| SMILES | CCCOC(=O)NC(Oc1ccccc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H13F6NO3/c1-2-8-22-10(21)20-11(12(14,15)16,13(17,18)19)23-9-6-4-3-5-7-9/h3-7H,2,8H2,1H3,(H,20,21) |
| InChIKey | CPCOISQASNZTSX-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.24 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|