C25H46O3Si — CID 23239386
methyl (9Z,12E,15Z)-11-triethylsilyloxyoctadeca-9,12,15-trienoate (PubChem CID 23239386) has the molecular formula C25H46O3Si and a molecular weight of 422.73 g/mol. Its IUPAC name is methyl (9Z,12E,15Z)-11-triethylsilyloxyoctadeca-9,12,15-trienoate.
| Compound Name | methyl (9Z,12E,15Z)-11-triethylsilyloxyoctadeca-9,12,15-trienoate |
|---|---|
| PubChem CID | 23239386 |
| Molecular Formula | C25H46O3Si |
| Molecular Weight | 422.73 g/mol |
| Exact Mass | 422.32 |
| IUPAC Name | methyl (9Z,12E,15Z)-11-triethylsilyloxyoctadeca-9,12,15-trienoate |
| SMILES | CC/C=C\C/C=C/C(/C=C\CCCCCCCC(=O)OC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C25H46O3Si/c1-6-10-11-15-18-21-24(28-29(7-2,8-3)9-4)22-19-16-13-12-14-17-20-23-25(26)27-5/h10-11,18-19,21-22,24H,6-9,12-17,20,23H2,1-5H3/b11-10-,21-18+,22-19- |
| InChIKey | USNDFOTXPPNGAW-LASTYGKBSA-N |
| XLogP | 7.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.73 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|