C18H34O4 — CID 23239475
ethyl 2-[(2R,4S,6R)-6-heptyl-2,5,5-trimethyl-1,3-dioxan-4-yl]acetate (PubChem CID 23239475) has the molecular formula C18H34O4 and a molecular weight of 314.47 g/mol. Its IUPAC name is ethyl 2-[(2R,4S,6R)-6-heptyl-2,5,5-trimethyl-1,3-dioxan-4-yl]acetate.
| Compound Name | ethyl 2-[(2R,4S,6R)-6-heptyl-2,5,5-trimethyl-1,3-dioxan-4-yl]acetate |
|---|---|
| PubChem CID | 23239475 |
| Molecular Formula | C18H34O4 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | ethyl 2-[(2R,4S,6R)-6-heptyl-2,5,5-trimethyl-1,3-dioxan-4-yl]acetate |
| SMILES | CCCCCCC[C@H]1O[C@@H](C)O[C@@H](CC(=O)OCC)C1(C)C |
| InChI | InChI=1S/C18H34O4/c1-6-8-9-10-11-12-15-18(4,5)16(22-14(3)21-15)13-17(19)20-7-2/h14-16H,6-13H2,1-5H3/t14-,15-,16+/m1/s1 |
| InChIKey | YWYYHEHDSUOARL-OAGGEKHMSA-N |
| XLogP | 4.46 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|