C14H21NO2S — CID 23240622
2,4,6-trimethyl-N-[(E)-3-methylbut-1-enyl]benzenesulfonamide (PubChem CID 23240622) has the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. Its IUPAC name is 2,4,6-trimethyl-N-[(E)-3-methylbut-1-enyl]benzenesulfonamide.
| Compound Name | 2,4,6-trimethyl-N-[(E)-3-methylbut-1-enyl]benzenesulfonamide |
|---|---|
| PubChem CID | 23240622 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 2,4,6-trimethyl-N-[(E)-3-methylbut-1-enyl]benzenesulfonamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)N/C=C/C(C)C)c(C)c1 |
| InChI | InChI=1S/C14H21NO2S/c1-10(2)6-7-15-18(16,17)14-12(4)8-11(3)9-13(14)5/h6-10,15H,1-5H3/b7-6+ |
| InChIKey | CAJXBDQCMRZIRS-VOTSOKGWSA-N |
| XLogP | 3.06 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |