C17H30N2O4S — CID 23240706
tert-butyl N-(3-methylbut-2-enyl)-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-C-methylsulfanylcarbonimidoyl]carbamate (PubChem CID 23240706) has the molecular formula C17H30N2O4S and a molecular weight of 358.50 g/mol. Its IUPAC name is tert-butyl N-(3-methylbut-2-enyl)-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-C-methylsulfanylcarbonimidoyl]carbamate.
| Compound Name | tert-butyl N-(3-methylbut-2-enyl)-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-C-methylsulfanylcarbonimidoyl]carbamate |
|---|---|
| PubChem CID | 23240706 |
| Molecular Formula | C17H30N2O4S |
| Molecular Weight | 358.50 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | tert-butyl N-(3-methylbut-2-enyl)-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-C-methylsulfanylcarbonimidoyl]carbamate |
| SMILES | CSC(=NC(=O)OC(C)(C)C)N(CC=C(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H30N2O4S/c1-12(2)10-11-19(15(21)23-17(6,7)8)13(24-9)18-14(20)22-16(3,4)5/h10H,11H2,1-9H3 |
| InChIKey | KBZWNVIHJSWMOF-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.50 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|