C15H27N3O6S — CID 19066898
2-[2-[(2-methylpropan-2-yl)oxycarbonyl-[(Z)-N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]amino]ethylsulfanyl]acetic acid (PubChem CID 19066898) has the molecular formula C15H27N3O6S and a molecular weight of 377.46 g/mol. Its IUPAC name is 2-[2-[(2-methylpropan-2-yl)oxycarbonyl-[(Z)-N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]amino]ethylsulfanyl]acetic acid.
| Compound Name | 2-[2-[(2-methylpropan-2-yl)oxycarbonyl-[(Z)-N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]amino]ethylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 19066898 |
| Molecular Formula | C15H27N3O6S |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 2-[2-[(2-methylpropan-2-yl)oxycarbonyl-[(Z)-N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]amino]ethylsulfanyl]acetic acid |
| SMILES | CC(C)(C)OC(=O)/N=C(/N)N(CCSCC(=O)O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H27N3O6S/c1-14(2,3)23-12(21)17-11(16)18(7-8-25-9-10(19)20)13(22)24-15(4,5)6/h7-9H2,1-6H3,(H,19,20)(H2,16,17,21) |
| InChIKey | SECVEDWRBKFRDU-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 131.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|