C14H30O4Si — CID 23240821
(2R,3S,4S)-2,4-dimethyl-3-(2-trimethylsilylethoxymethoxy)hex-5-ene-1,2-diol (PubChem CID 23240821) has the molecular formula C14H30O4Si and a molecular weight of 290.48 g/mol. Its IUPAC name is (2R,3S,4S)-2,4-dimethyl-3-(2-trimethylsilylethoxymethoxy)hex-5-ene-1,2-diol.
| Compound Name | (2R,3S,4S)-2,4-dimethyl-3-(2-trimethylsilylethoxymethoxy)hex-5-ene-1,2-diol |
|---|---|
| PubChem CID | 23240821 |
| Molecular Formula | C14H30O4Si |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | (2R,3S,4S)-2,4-dimethyl-3-(2-trimethylsilylethoxymethoxy)hex-5-ene-1,2-diol |
| SMILES | C=C[C@H](C)[C@H](OCOCC[Si](C)(C)C)[C@](C)(O)CO |
| InChI | InChI=1S/C14H30O4Si/c1-7-12(2)13(14(3,16)10-15)18-11-17-8-9-19(4,5)6/h7,12-13,15-16H,1,8-11H2,2-6H3/t12-,13-,14+/m0/s1 |
| InChIKey | HRFHPZWIVOGFJC-MELADBBJSA-N |
| XLogP | 2.25 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|