C25H40O7 — CID 23242502
dimethyl 2-[(2Z,4E,6S,7S,10Z)-11-(2,2-dimethyl-1,3-dioxolan-4-yl)-7-methoxy-2,6,10-trimethylundeca-2,4,10-trienyl]propanedioate (PubChem CID 23242502) has the molecular formula C25H40O7 and a molecular weight of 452.59 g/mol. Its IUPAC name is dimethyl 2-[(2Z,4E,6S,7S,10Z)-11-(2,2-dimethyl-1,3-dioxolan-4-yl)-7-methoxy-2,6,10-trimethylundeca-2,4,10-trienyl]propanedioate.
| Compound Name | dimethyl 2-[(2Z,4E,6S,7S,10Z)-11-(2,2-dimethyl-1,3-dioxolan-4-yl)-7-methoxy-2,6,10-trimethylundeca-2,4,10-trienyl]propanedioate |
|---|---|
| PubChem CID | 23242502 |
| Molecular Formula | C25H40O7 |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | dimethyl 2-[(2Z,4E,6S,7S,10Z)-11-(2,2-dimethyl-1,3-dioxolan-4-yl)-7-methoxy-2,6,10-trimethylundeca-2,4,10-trienyl]propanedioate |
| SMILES | COC(=O)C(C/C(C)=C\C=C\[C@H](C)[C@H](CC/C(C)=C\C1COC(C)(C)O1)OC)C(=O)OC |
| InChI | InChI=1S/C25H40O7/c1-17(15-21(23(26)29-7)24(27)30-8)10-9-11-19(3)22(28-6)13-12-18(2)14-20-16-31-25(4,5)32-20/h9-11,14,19-22H,12-13,15-16H2,1-8H3/b11-9+,17-10-,18-14-/t19-,20?,22-/m0/s1 |
| InChIKey | UJOBAVPFOMZKDM-PONJGILYSA-N |
| XLogP | 4.37 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|