C21H28O8S — CID 23244678
dimethyl 2-[1-hydroxy-2-(4-methylphenyl)sulfinyl-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]cyclopropane-1,1-dicarboxylate (PubChem CID 23244678) has the molecular formula C21H28O8S and a molecular weight of 440.51 g/mol. Its IUPAC name is dimethyl 2-[1-hydroxy-2-(4-methylphenyl)sulfinyl-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]cyclopropane-1,1-dicarboxylate.
| Compound Name | dimethyl 2-[1-hydroxy-2-(4-methylphenyl)sulfinyl-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]cyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 23244678 |
| Molecular Formula | C21H28O8S |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | dimethyl 2-[1-hydroxy-2-(4-methylphenyl)sulfinyl-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]cyclopropane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC1C(O)C(C(=O)OC(C)(C)C)S(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H28O8S/c1-12-7-9-13(10-8-12)30(26)16(17(23)29-20(2,3)4)15(22)14-11-21(14,18(24)27-5)19(25)28-6/h7-10,14-16,22H,11H2,1-6H3 |
| InChIKey | BESXEIBCMDTUIH-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|