C15H12Cl3NO3 — CID 23246702
[(Z)-(5,5,6-trichloro-2-methyl-4-oxocyclohex-2-en-1-ylidene)amino] 4-methylbenzoate (PubChem CID 23246702) has the molecular formula C15H12Cl3NO3 and a molecular weight of 360.62 g/mol. Its IUPAC name is [(Z)-(5,5,6-trichloro-2-methyl-4-oxocyclohex-2-en-1-ylidene)amino] 4-methylbenzoate.
| Compound Name | [(Z)-(5,5,6-trichloro-2-methyl-4-oxocyclohex-2-en-1-ylidene)amino] 4-methylbenzoate |
|---|---|
| PubChem CID | 23246702 |
| Molecular Formula | C15H12Cl3NO3 |
| Molecular Weight | 360.62 g/mol |
| Exact Mass | 358.99 |
| IUPAC Name | [(Z)-(5,5,6-trichloro-2-methyl-4-oxocyclohex-2-en-1-ylidene)amino] 4-methylbenzoate |
| SMILES | CC1=CC(=O)C(Cl)(Cl)C(Cl)/C1=N\OC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H12Cl3NO3/c1-8-3-5-10(6-4-8)14(21)22-19-12-9(2)7-11(20)15(17,18)13(12)16/h3-7,13H,1-2H3/b19-12- |
| InChIKey | VDUKYAOJLIPBFY-UNOMPAQXSA-N |
| XLogP | 3.82 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.62 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|