C18H17Cl4NO2 — CID 34071923
N-[(5R,6S)-5-tert-butyl-2,3,5,6-tetrachloro-4-oxocyclohex-2-en-1-ylidene]-4-methylbenzamide (PubChem CID 34071923) has the molecular formula C18H17Cl4NO2 and a molecular weight of 421.15 g/mol. Its IUPAC name is N-[(5R,6S)-5-tert-butyl-2,3,5,6-tetrachloro-4-oxocyclohex-2-en-1-ylidene]-4-methylbenzamide.
| Compound Name | N-[(5R,6S)-5-tert-butyl-2,3,5,6-tetrachloro-4-oxocyclohex-2-en-1-ylidene]-4-methylbenzamide |
|---|---|
| PubChem CID | 34071923 |
| Molecular Formula | C18H17Cl4NO2 |
| Molecular Weight | 421.15 g/mol |
| Exact Mass | 419.00 |
| IUPAC Name | N-[(5R,6S)-5-tert-butyl-2,3,5,6-tetrachloro-4-oxocyclohex-2-en-1-ylidene]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)/N=C2\C(Cl)=C(Cl)C(=O)[C@](Cl)(C(C)(C)C)[C@H]2Cl)cc1 |
| InChI | InChI=1S/C18H17Cl4NO2/c1-9-5-7-10(8-6-9)16(25)23-13-11(19)12(20)15(24)18(22,14(13)21)17(2,3)4/h5-8,14H,1-4H3/b23-13+/t14-,18-/m0/s1 |
| InChIKey | VLLAYAKXNFZRRZ-BXVPSSOQSA-N |
| XLogP | 5.48 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.15 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|