C23H29NO7 — CID 23247023
(6R)-6-[[(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]-5-methylidene-3-phenyl-4H-oxazine (PubChem CID 23247023) has the molecular formula C23H29NO7 and a molecular weight of 431.49 g/mol. Its IUPAC name is (6R)-6-[[(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]-5-methylidene-3-phenyl-4H-oxazine.
| Compound Name | (6R)-6-[[(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]-5-methylidene-3-phenyl-4H-oxazine |
|---|---|
| PubChem CID | 23247023 |
| Molecular Formula | C23H29NO7 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | (6R)-6-[[(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]-5-methylidene-3-phenyl-4H-oxazine |
| SMILES | C=C1CC(c2ccccc2)=NO[C@H]1O[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C23H29NO7/c1-13-11-15(14-9-7-6-8-10-14)24-31-20(13)27-18-17(16-12-25-22(2,3)28-16)26-21-19(18)29-23(4,5)30-21/h6-10,16-21H,1,11-12H2,2-5H3/t16-,17-,18+,19-,20-,21-/m1/s1 |
| InChIKey | GTNWOORCPIDKII-JMPUJIDWSA-N |
| XLogP | 3.11 |
| TPSA | 76.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|