C38H40N4O7 — CID 23248650
9H-fluoren-9-ylmethyl N-[3-[(2S,3S,4R,5R,6R)-6-(azidomethyl)-3-hydroxy-4,5-bis(phenylmethoxy)oxan-2-yl]oxypropyl]carbamate (PubChem CID 23248650) has the molecular formula C38H40N4O7 and a molecular weight of 664.76 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-[(2S,3S,4R,5R,6R)-6-(azidomethyl)-3-hydroxy-4,5-bis(phenylmethoxy)oxan-2-yl]oxypropyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-[(2S,3S,4R,5R,6R)-6-(azidomethyl)-3-hydroxy-4,5-bis(phenylmethoxy)oxan-2-yl]oxypropyl]carbamate |
|---|---|
| PubChem CID | 23248650 |
| Molecular Formula | C38H40N4O7 |
| Molecular Weight | 664.76 g/mol |
| Exact Mass | 664.29 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-[(2S,3S,4R,5R,6R)-6-(azidomethyl)-3-hydroxy-4,5-bis(phenylmethoxy)oxan-2-yl]oxypropyl]carbamate |
| SMILES | [N-]=[N+]=NC[C@H]1O[C@H](OCCCNC(=O)OCC2c3ccccc3-c3ccccc32)[C@@H](O)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C38H40N4O7/c39-42-41-22-33-35(46-23-26-12-3-1-4-13-26)36(47-24-27-14-5-2-6-15-27)34(43)37(49-33)45-21-11-20-40-38(44)48-25-32-30-18-9-7-16-28(30)29-17-8-10-19-31(29)32/h1-10,12-19,32-37,43H,11,20-25H2,(H,40,44)/t33-,34+,35-,36-,37+/m1/s1 |
| InChIKey | UAWPFVYWVDNSMJ-ORIAJCIFSA-N |
| XLogP | 6.50 |
| TPSA | 144.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.76 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|