C24H23NO3 — CID 23251690
methyl (1S,2S)-1-hydroxy-9-methyl-1-phenyl-2-prop-2-ynyl-3,4-dihydrocarbazole-2-carboxylate (PubChem CID 23251690) has the molecular formula C24H23NO3 and a molecular weight of 373.45 g/mol. Its IUPAC name is methyl (1S,2S)-1-hydroxy-9-methyl-1-phenyl-2-prop-2-ynyl-3,4-dihydrocarbazole-2-carboxylate.
| Compound Name | methyl (1S,2S)-1-hydroxy-9-methyl-1-phenyl-2-prop-2-ynyl-3,4-dihydrocarbazole-2-carboxylate |
|---|---|
| PubChem CID | 23251690 |
| Molecular Formula | C24H23NO3 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | methyl (1S,2S)-1-hydroxy-9-methyl-1-phenyl-2-prop-2-ynyl-3,4-dihydrocarbazole-2-carboxylate |
| SMILES | C#CC[C@@]1(C(=O)OC)CCc2c(n(C)c3ccccc23)[C@]1(O)c1ccccc1 |
| InChI | InChI=1S/C24H23NO3/c1-4-15-23(22(26)28-3)16-14-19-18-12-8-9-13-20(18)25(2)21(19)24(23,27)17-10-6-5-7-11-17/h1,5-13,27H,14-16H2,2-3H3/t23-,24+/m0/s1 |
| InChIKey | MVKMQXPQBBTPCJ-BJKOFHAPSA-N |
| XLogP | 3.54 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|