C14H23F3N2+2 — CID 23252439
ethyl-phenyl-[4-(2,2,2-trifluoroethylazaniumyl)butyl]azanium (PubChem CID 23252439) has the molecular formula C14H23F3N2+2 and a molecular weight of 276.35 g/mol. Its IUPAC name is ethyl-phenyl-[4-(2,2,2-trifluoroethylazaniumyl)butyl]azanium.
| Compound Name | ethyl-phenyl-[4-(2,2,2-trifluoroethylazaniumyl)butyl]azanium |
|---|---|
| PubChem CID | 23252439 |
| Molecular Formula | C14H23F3N2+2 |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | ethyl-phenyl-[4-(2,2,2-trifluoroethylazaniumyl)butyl]azanium |
| SMILES | CC[NH+](CCCC[NH2+]CC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C14H21F3N2/c1-2-19(13-8-4-3-5-9-13)11-7-6-10-18-12-14(15,16)17/h3-5,8-9,18H,2,6-7,10-12H2,1H3/p+2 |
| InChIKey | HYXZDWRJFOZUNN-UHFFFAOYSA-P |
| XLogP | 1.13 |
| TPSA | 21.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|