C14H24O2 — CID 23252953
2-(3-ethenylpent-3-enyl)-2,5,5-trimethyl-1,3-dioxane (PubChem CID 23252953) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is 2-(3-ethenylpent-3-enyl)-2,5,5-trimethyl-1,3-dioxane.
| Compound Name | 2-(3-ethenylpent-3-enyl)-2,5,5-trimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 23252953 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 2-(3-ethenylpent-3-enyl)-2,5,5-trimethyl-1,3-dioxane |
| SMILES | C=CC(=CC)CCC1(C)OCC(C)(C)CO1 |
| InChI | InChI=1S/C14H24O2/c1-6-12(7-2)8-9-14(5)15-10-13(3,4)11-16-14/h6-7H,1,8-11H2,2-5H3 |
| InChIKey | PLJVSFAPCRYRFA-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|