C18H30O4 — CID 23253312
methyl (2R)-2-[(2S,3S,5R,6R,8R)-8-ethyl-3,5-dimethyl-9-methylidene-1,7-dioxaspiro[5.5]undecan-2-yl]propanoate (PubChem CID 23253312) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is methyl (2R)-2-[(2S,3S,5R,6R,8R)-8-ethyl-3,5-dimethyl-9-methylidene-1,7-dioxaspiro[5.5]undecan-2-yl]propanoate.
| Compound Name | methyl (2R)-2-[(2S,3S,5R,6R,8R)-8-ethyl-3,5-dimethyl-9-methylidene-1,7-dioxaspiro[5.5]undecan-2-yl]propanoate |
|---|---|
| PubChem CID | 23253312 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | methyl (2R)-2-[(2S,3S,5R,6R,8R)-8-ethyl-3,5-dimethyl-9-methylidene-1,7-dioxaspiro[5.5]undecan-2-yl]propanoate |
| SMILES | C=C1CC[C@@]2(O[C@H]([C@@H](C)C(=O)OC)[C@@H](C)C[C@H]2C)O[C@@H]1CC |
| InChI | InChI=1S/C18H30O4/c1-7-15-11(2)8-9-18(21-15)13(4)10-12(3)16(22-18)14(5)17(19)20-6/h12-16H,2,7-10H2,1,3-6H3/t12-,13+,14+,15+,16-,18-/m0/s1 |
| InChIKey | OZRYIJMDIUCOHG-AJIJBZLRSA-N |
| XLogP | 3.70 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|