C27H50O6Si — CID 23253344
methyl (E,2R,3S,4S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-9-[(4S,5R)-5-ethyl-2,2,4-trimethyl-1,3-dioxolan-4-yl]-2,4,6-trimethyl-7-oxonon-8-enoate (PubChem CID 23253344) has the molecular formula C27H50O6Si and a molecular weight of 498.78 g/mol. Its IUPAC name is methyl (E,2R,3S,4S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-9-[(4S,5R)-5-ethyl-2,2,4-trimethyl-1,3-dioxolan-4-yl]-2,4,6-trimethyl-7-oxonon-8-enoate.
| Compound Name | methyl (E,2R,3S,4S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-9-[(4S,5R)-5-ethyl-2,2,4-trimethyl-1,3-dioxolan-4-yl]-2,4,6-trimethyl-7-oxonon-8-enoate |
|---|---|
| PubChem CID | 23253344 |
| Molecular Formula | C27H50O6Si |
| Molecular Weight | 498.78 g/mol |
| Exact Mass | 498.34 |
| IUPAC Name | methyl (E,2R,3S,4S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-9-[(4S,5R)-5-ethyl-2,2,4-trimethyl-1,3-dioxolan-4-yl]-2,4,6-trimethyl-7-oxonon-8-enoate |
| SMILES | CC[C@H]1OC(C)(C)O[C@@]1(C)/C=C/C(=O)[C@H](C)C[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)OC |
| InChI | InChI=1S/C27H50O6Si/c1-14-22-27(10,33-26(8,9)31-22)16-15-21(28)18(2)17-19(3)23(20(4)24(29)30-11)32-34(12,13)25(5,6)7/h15-16,18-20,22-23H,14,17H2,1-13H3/b16-15+/t18-,19+,20-,22-,23+,27+/m1/s1 |
| InChIKey | DDOLBLIUTZPWIG-LPPATHAUSA-N |
| XLogP | 6.29 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.78 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|