C30H52O9Si — CID 57044839
[3-acetyloxy-6-hydroxy-2-(2-methoxypropan-2-yloxy)-6-(2-octyl-5-oxo-2-trimethylsilyloxycyclopent-3-en-1-yl)hex-4-enyl] acetate (PubChem CID 57044839) has the molecular formula C30H52O9Si and a molecular weight of 584.82 g/mol. Its IUPAC name is [3-acetyloxy-6-hydroxy-2-(2-methoxypropan-2-yloxy)-6-(2-octyl-5-oxo-2-trimethylsilyloxycyclopent-3-en-1-yl)hex-4-enyl] acetate.
| Compound Name | [3-acetyloxy-6-hydroxy-2-(2-methoxypropan-2-yloxy)-6-(2-octyl-5-oxo-2-trimethylsilyloxycyclopent-3-en-1-yl)hex-4-enyl] acetate |
|---|---|
| PubChem CID | 57044839 |
| Molecular Formula | C30H52O9Si |
| Molecular Weight | 584.82 g/mol |
| Exact Mass | 584.34 |
| IUPAC Name | [3-acetyloxy-6-hydroxy-2-(2-methoxypropan-2-yloxy)-6-(2-octyl-5-oxo-2-trimethylsilyloxycyclopent-3-en-1-yl)hex-4-enyl] acetate |
| SMILES | CCCCCCCCC1(O[Si](C)(C)C)C=CC(=O)C1C(O)C=CC(OC(C)=O)C(COC(C)=O)OC(C)(C)OC |
| InChI | InChI=1S/C30H52O9Si/c1-10-11-12-13-14-15-19-30(39-40(7,8)9)20-18-25(34)28(30)24(33)16-17-26(37-23(3)32)27(21-36-22(2)31)38-29(4,5)35-6/h16-18,20,24,26-28,33H,10-15,19,21H2,1-9H3 |
| InChIKey | ODRPTAOOYIVUGJ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.82 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|