C21H35NO5S — CID 23254898
methyl 5-[(3aS,5R,6S,6aR)-5-hydroxy-6-[(E,3S)-3-hydroxyoct-1-enyl]-3a-methoxy-4,5,6,6a-tetrahydrocyclopenta[d][1,3]thiazol-2-yl]pentanoate (PubChem CID 23254898) has the molecular formula C21H35NO5S and a molecular weight of 413.58 g/mol. Its IUPAC name is methyl 5-[(3aS,5R,6S,6aR)-5-hydroxy-6-[(E,3S)-3-hydroxyoct-1-enyl]-3a-methoxy-4,5,6,6a-tetrahydrocyclopenta[d][1,3]thiazol-2-yl]pentanoate.
| Compound Name | methyl 5-[(3aS,5R,6S,6aR)-5-hydroxy-6-[(E,3S)-3-hydroxyoct-1-enyl]-3a-methoxy-4,5,6,6a-tetrahydrocyclopenta[d][1,3]thiazol-2-yl]pentanoate |
|---|---|
| PubChem CID | 23254898 |
| Molecular Formula | C21H35NO5S |
| Molecular Weight | 413.58 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | methyl 5-[(3aS,5R,6S,6aR)-5-hydroxy-6-[(E,3S)-3-hydroxyoct-1-enyl]-3a-methoxy-4,5,6,6a-tetrahydrocyclopenta[d][1,3]thiazol-2-yl]pentanoate |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1[C@H](O)C[C@@]2(OC)N=C(CCCCC(=O)OC)S[C@H]12 |
| InChI | InChI=1S/C21H35NO5S/c1-4-5-6-9-15(23)12-13-16-17(24)14-21(27-3)20(16)28-18(22-21)10-7-8-11-19(25)26-2/h12-13,15-17,20,23-24H,4-11,14H2,1-3H3/b13-12+/t15-,16-,17+,20+,21-/m0/s1 |
| InChIKey | KAFNUMNRCAGAOO-YLUPAZHLSA-N |
| XLogP | 3.45 |
| TPSA | 88.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.58 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|