C16H14O3S — CID 23255376
(1S,2R,6S,7R)-5-hydroxy-4-(phenylsulfanylmethyl)-10-oxatricyclo[5.2.1.02,6]deca-4,8-dien-3-one (PubChem CID 23255376) has the molecular formula C16H14O3S and a molecular weight of 286.35 g/mol. Its IUPAC name is (1S,2R,6S,7R)-5-hydroxy-4-(phenylsulfanylmethyl)-10-oxatricyclo[5.2.1.02,6]deca-4,8-dien-3-one.
| Compound Name | (1S,2R,6S,7R)-5-hydroxy-4-(phenylsulfanylmethyl)-10-oxatricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
|---|---|
| PubChem CID | 23255376 |
| Molecular Formula | C16H14O3S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | (1S,2R,6S,7R)-5-hydroxy-4-(phenylsulfanylmethyl)-10-oxatricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
| SMILES | O=C1C(CSc2ccccc2)=C(O)[C@H]2[C@@H]1[C@@H]1C=C[C@H]2O1 |
| InChI | InChI=1S/C16H14O3S/c17-15-10(8-20-9-4-2-1-3-5-9)16(18)14-12-7-6-11(19-12)13(14)15/h1-7,11-14,17H,8H2/t11-,12+,13-,14+/m1/s1 |
| InChIKey | SBFQZQUKJITJEB-RQJABVFESA-N |
| XLogP | 2.74 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|