C17H16O4S — CID 23255379
(1R,2S,6R,7S)-4-[(4-methylphenyl)sulfonylmethyl]-10-oxatricyclo[5.2.1.02,6]deca-4,8-dien-3-one (PubChem CID 23255379) has the molecular formula C17H16O4S and a molecular weight of 316.38 g/mol. Its IUPAC name is (1R,2S,6R,7S)-4-[(4-methylphenyl)sulfonylmethyl]-10-oxatricyclo[5.2.1.02,6]deca-4,8-dien-3-one.
| Compound Name | (1R,2S,6R,7S)-4-[(4-methylphenyl)sulfonylmethyl]-10-oxatricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
|---|---|
| PubChem CID | 23255379 |
| Molecular Formula | C17H16O4S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | (1R,2S,6R,7S)-4-[(4-methylphenyl)sulfonylmethyl]-10-oxatricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
| SMILES | Cc1ccc(S(=O)(=O)CC2=C[C@@H]3[C@H](C2=O)[C@H]2C=C[C@@H]3O2)cc1 |
| InChI | InChI=1S/C17H16O4S/c1-10-2-4-12(5-3-10)22(19,20)9-11-8-13-14-6-7-15(21-14)16(13)17(11)18/h2-8,13-16H,9H2,1H3/t13-,14-,15+,16-/m0/s1 |
| InChIKey | BTPLMPOPZZFKPB-JONQDZQNSA-N |
| XLogP | 1.85 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|