C16H14O2S — CID 595110
4-(phenylsulfanylmethyl)-10-oxatricyclo[5.2.1.02,6]deca-4,8-dien-3-one (PubChem CID 595110) has the molecular formula C16H14O2S and a molecular weight of 270.35 g/mol. Its IUPAC name is 4-(phenylsulfanylmethyl)-10-oxatricyclo[5.2.1.02,6]deca-4,8-dien-3-one.
| Compound Name | 4-(phenylsulfanylmethyl)-10-oxatricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
|---|---|
| PubChem CID | 595110 |
| Molecular Formula | C16H14O2S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 4-(phenylsulfanylmethyl)-10-oxatricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
| SMILES | O=C1C(CSc2ccccc2)=CC2C3C=CC(O3)C12 |
| InChI | InChI=1S/C16H14O2S/c17-16-10(9-19-11-4-2-1-3-5-11)8-12-13-6-7-14(18-13)15(12)16/h1-8,12-15H,9H2 |
| InChIKey | RCLZTBKSFLYWEZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|