C17H16O2S — CID 23255385
(1R,2S,6R,7S)-4-(benzylsulfanylmethyl)-10-oxatricyclo[5.2.1.02,6]deca-4,8-dien-3-one (PubChem CID 23255385) has the molecular formula C17H16O2S and a molecular weight of 284.38 g/mol. Its IUPAC name is (1R,2S,6R,7S)-4-(benzylsulfanylmethyl)-10-oxatricyclo[5.2.1.02,6]deca-4,8-dien-3-one.
| Compound Name | (1R,2S,6R,7S)-4-(benzylsulfanylmethyl)-10-oxatricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
|---|---|
| PubChem CID | 23255385 |
| Molecular Formula | C17H16O2S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | (1R,2S,6R,7S)-4-(benzylsulfanylmethyl)-10-oxatricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
| SMILES | O=C1C(CSCc2ccccc2)=C[C@@H]2[C@H]1[C@H]1C=C[C@@H]2O1 |
| InChI | InChI=1S/C17H16O2S/c18-17-12(10-20-9-11-4-2-1-3-5-11)8-13-14-6-7-15(19-14)16(13)17/h1-8,13-16H,9-10H2/t13-,14-,15+,16-/m0/s1 |
| InChIKey | PXNAQMOZDSXIOY-JONQDZQNSA-N |
| XLogP | 3.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|