C14H20O4 — CID 23255977
[(1S,3S,5S,6S,9Z,13S)-4,14-dioxatricyclo[11.1.0.03,5]tetradec-9-en-6-yl] acetate (PubChem CID 23255977) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is [(1S,3S,5S,6S,9Z,13S)-4,14-dioxatricyclo[11.1.0.03,5]tetradec-9-en-6-yl] acetate.
| Compound Name | [(1S,3S,5S,6S,9Z,13S)-4,14-dioxatricyclo[11.1.0.03,5]tetradec-9-en-6-yl] acetate |
|---|---|
| PubChem CID | 23255977 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | [(1S,3S,5S,6S,9Z,13S)-4,14-dioxatricyclo[11.1.0.03,5]tetradec-9-en-6-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC/C=C\CC[C@@H]2O[C@H]2C[C@@H]2O[C@H]12 |
| InChI | InChI=1S/C14H20O4/c1-9(15)16-11-7-5-3-2-4-6-10-12(17-10)8-13-14(11)18-13/h2-3,10-14H,4-8H2,1H3/b3-2-/t10-,11-,12-,13-,14+/m0/s1 |
| InChIKey | UHRJDMGJEQYFIM-UBTLDHEESA-N |
| XLogP | 1.97 |
| TPSA | 51.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|