C26H24O5 — CID 23257682
dimethyl 1-(4-methoxyphenyl)-5,6,8-trimethylacenaphthylene-3,4-dicarboxylate (PubChem CID 23257682) has the molecular formula C26H24O5 and a molecular weight of 416.47 g/mol. Its IUPAC name is dimethyl 1-(4-methoxyphenyl)-5,6,8-trimethylacenaphthylene-3,4-dicarboxylate.
| Compound Name | dimethyl 1-(4-methoxyphenyl)-5,6,8-trimethylacenaphthylene-3,4-dicarboxylate |
|---|---|
| PubChem CID | 23257682 |
| Molecular Formula | C26H24O5 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | dimethyl 1-(4-methoxyphenyl)-5,6,8-trimethylacenaphthylene-3,4-dicarboxylate |
| SMILES | COC(=O)c1c(C(=O)OC)c2c3c(c(C)cc(C)c3c1C)C(c1ccc(OC)cc1)=C2 |
| InChI | InChI=1S/C26H24O5/c1-13-11-14(2)21-18(16-7-9-17(29-4)10-8-16)12-19-23(21)20(13)15(3)22(25(27)30-5)24(19)26(28)31-6/h7-12H,1-6H3 |
| InChIKey | FQMKYYPNXPYGNF-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|