C12H18O4 — CID 23262644
(5R,6aR)-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 23262644) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is (5R,6aR)-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (5R,6aR)-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 23262644 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | (5R,6aR)-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | O=C1CC2C[C@@H](OC3CCCCO3)C[C@H]2O1 |
| InChI | InChI=1S/C12H18O4/c13-11-6-8-5-9(7-10(8)16-11)15-12-3-1-2-4-14-12/h8-10,12H,1-7H2/t8?,9-,10-,12?/m1/s1 |
| InChIKey | HYOOMULOWIAJAA-WDHPUFTPSA-N |
| XLogP | 1.62 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |