C8H8F6 — CID 23263358
1,1,1,3,3,3-hexafluoropropan-2-ylidenecyclopentane (PubChem CID 23263358) has the molecular formula C8H8F6 and a molecular weight of 218.14 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-ylidenecyclopentane.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-ylidenecyclopentane |
|---|---|
| PubChem CID | 23263358 |
| Molecular Formula | C8H8F6 |
| Molecular Weight | 218.14 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-ylidenecyclopentane |
| SMILES | FC(F)(F)C(=C1CCCC1)C(F)(F)F |
| InChI | InChI=1S/C8H8F6/c9-7(10,11)6(8(12,13)14)5-3-1-2-4-5/h1-4H2 |
| InChIKey | UVODFUOUVYCKPM-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.14 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|