C8H4F10 — CID 57164011
1,1,2,2-tetrafluoro-3-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)cyclopentane (PubChem CID 57164011) has the molecular formula C8H4F10 and a molecular weight of 290.10 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-3-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)cyclopentane.
| Compound Name | 1,1,2,2-tetrafluoro-3-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)cyclopentane |
|---|---|
| PubChem CID | 57164011 |
| Molecular Formula | C8H4F10 |
| Molecular Weight | 290.10 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | 1,1,2,2-tetrafluoro-3-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)cyclopentane |
| SMILES | FC(F)(F)C(=C1CCC(F)(F)C1(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H4F10/c9-5(10)2-1-3(6(5,11)12)4(7(13,14)15)8(16,17)18/h1-2H2 |
| InChIKey | BZYSJPIYNJWJOA-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.10 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|