C18H17NO — CID 23263886
14-ethyl-15-methyl-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9(16),10,12-hexaen-8-one (PubChem CID 23263886) has the molecular formula C18H17NO and a molecular weight of 263.34 g/mol. Its IUPAC name is 14-ethyl-15-methyl-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9(16),10,12-hexaen-8-one.
| Compound Name | 14-ethyl-15-methyl-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9(16),10,12-hexaen-8-one |
|---|---|
| PubChem CID | 23263886 |
| Molecular Formula | C18H17NO |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 14-ethyl-15-methyl-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9(16),10,12-hexaen-8-one |
| SMILES | CCN1c2cccc3c2C(c2ccccc2C3=O)C1C |
| InChI | InChI=1S/C18H17NO/c1-3-19-11(2)16-12-7-4-5-8-13(12)18(20)14-9-6-10-15(19)17(14)16/h4-11,16H,3H2,1-2H3 |
| InChIKey | RZCXCOWZQQPWSP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |