C20H20N2O6 — CID 23266058
pyridin-3-yl-[1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]indol-3-yl]methanone (PubChem CID 23266058) has the molecular formula C20H20N2O6 and a molecular weight of 384.39 g/mol. Its IUPAC name is pyridin-3-yl-[1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]indol-3-yl]methanone.
| Compound Name | pyridin-3-yl-[1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]indol-3-yl]methanone |
|---|---|
| PubChem CID | 23266058 |
| Molecular Formula | C20H20N2O6 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | pyridin-3-yl-[1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]indol-3-yl]methanone |
| SMILES | O=C(c1cccnc1)c1cn([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c2ccccc12 |
| InChI | InChI=1S/C20H20N2O6/c23-10-15-17(25)18(26)19(27)20(28-15)22-9-13(12-5-1-2-6-14(12)22)16(24)11-4-3-7-21-8-11/h1-9,15,17-20,23,25-27H,10H2/t15-,17-,18+,19-,20-/m1/s1 |
| InChIKey | UFRQOVZIQIBOMZ-XIKSMUEASA-N |
| XLogP | 0.24 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |