C21H44O2Si2 — CID 23267866
[(4Z,8Z)-4,8-dimethyl-12-trimethylsilyloxytrideca-4,8-dienoxy]-trimethylsilane (PubChem CID 23267866) has the molecular formula C21H44O2Si2 and a molecular weight of 384.75 g/mol. Its IUPAC name is [(4Z,8Z)-4,8-dimethyl-12-trimethylsilyloxytrideca-4,8-dienoxy]-trimethylsilane.
| Compound Name | [(4Z,8Z)-4,8-dimethyl-12-trimethylsilyloxytrideca-4,8-dienoxy]-trimethylsilane |
|---|---|
| PubChem CID | 23267866 |
| Molecular Formula | C21H44O2Si2 |
| Molecular Weight | 384.75 g/mol |
| Exact Mass | 384.29 |
| IUPAC Name | [(4Z,8Z)-4,8-dimethyl-12-trimethylsilyloxytrideca-4,8-dienoxy]-trimethylsilane |
| SMILES | C/C(=C/CCC(C)O[Si](C)(C)C)CC/C=C(/C)CCCO[Si](C)(C)C |
| InChI | InChI=1S/C21H44O2Si2/c1-19(15-11-17-21(3)23-25(7,8)9)13-10-14-20(2)16-12-18-22-24(4,5)6/h14-15,21H,10-13,16-18H2,1-9H3/b19-15-,20-14- |
| InChIKey | ALRVXDICUWVCHM-REYIWKOGSA-N |
| XLogP | 7.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.75 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|